| dbo:abstract
|
- Rimegepant ist ein Arzneistoff aus der Wirkstoffklasse der niedermolekularen CGRP-Rezeptorantagonisten (Gepante). Er wird zur Behandlung akuter Migräneattacken sowie auch zur Vorbeugung (Prophylaxe) bei episodischer Migräne angewendet. Rimegepant ist peroral wirksam. (de)
- Rimegepant, sold under the brand name Nurtec ODT among others, is a medication used for the acute treatment of migraine with or without aura in adults and the preventative treatment of episodic migraine in adults. It is taken by mouth to dissolve on or under the tongue. It works by blocking CGRP receptors. In the United States, rimegepant was approved for treating acute migraine in February 2020, and its approval was extended to preventing episodic migraine in June 2021. It is produced and marketed by Pfizer. In March 2021, rimegepant was approved for medical use in the United Arab Emirates and in Israel. (en)
- Римегепант — лекарственный препарат для лечения мигрени. Одобрен для применения: США (2020). (ru)
|
| dbo:alternativeName
| |
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:class
| |
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:medlinePlus
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 12050 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:dailymedid
| |
| dbp:drugbank
| |
| dbp:f
| |
| dbp:h
| |
| dbp:iupacName
|
- [-5-Amino-6--6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-yl] 4-piperidine-1-carboxylate (en)
|
| dbp:kegg
| |
| dbp:legalEu
| |
| dbp:legalStatus
| |
| dbp:legalUs
| |
| dbp:medlineplus
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- N[C@@H]1c2cccnc2[C@H]CC[C@H]1c1ccccc1F (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- KRNAOFGYEFKHPB-ANJVHQHFSA-N (en)
|
| dbp:synonyms
|
- BHV-3000, BMS-927711 (en)
|
| dbp:tradename
| |
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Rimegepant ist ein Arzneistoff aus der Wirkstoffklasse der niedermolekularen CGRP-Rezeptorantagonisten (Gepante). Er wird zur Behandlung akuter Migräneattacken sowie auch zur Vorbeugung (Prophylaxe) bei episodischer Migräne angewendet. Rimegepant ist peroral wirksam. (de)
- Римегепант — лекарственный препарат для лечения мигрени. Одобрен для применения: США (2020). (ru)
- Rimegepant, sold under the brand name Nurtec ODT among others, is a medication used for the acute treatment of migraine with or without aura in adults and the preventative treatment of episodic migraine in adults. It is taken by mouth to dissolve on or under the tongue. It works by blocking CGRP receptors. (en)
|
| rdfs:label
|
- Rimegepant (de)
- Rimegepant (en)
- Римегепант (ru)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
