| dbo:abstract
|
- L'ubrogepant est une molécule inhibitrice du récepteur au peptide relié au gène calcitonine, utilisé comme médicament de la migraine. (fr)
- Ubrogepant, sold under the brand name Ubrelvy, is a medication used for the acute (immediate) treatment of migraine with or without aura (a sensory phenomenon or visual disturbance) in adults. It is not indicated for the preventive treatment of migraine. Ubrogepant is a small-molecule calcitonin gene-related peptide receptor antagonist. It is the first drug in this class approved for the acute treatment of migraine. The most common side effects are nausea, tiredness and dry mouth. Ubrogepant is contraindicated for co-administration with strong CYP3A4 inhibitors. (en)
- Уброгепант — лекарственный препарат для лечения мигрени. Одобрен для применения: США(2019). (ru)
|
| dbo:alternativeName
| |
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:medlinePlus
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 9006 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:dailymedid
| |
| dbp:drugbank
| |
| dbp:f
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:kegg
| |
| dbp:legalUs
| |
| dbp:medlineplus
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:pubchemsubstance
| |
| dbp:smiles
|
- C[C@@H]1[C@H]C[C@H]CN1CCF (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- DDOOFTLHJSMHLN-ZQHRPCGSSA-N (en)
|
| dbp:synonyms
| |
| dbp:tradename
| |
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- L'ubrogepant est une molécule inhibitrice du récepteur au peptide relié au gène calcitonine, utilisé comme médicament de la migraine. (fr)
- Ubrogepant, sold under the brand name Ubrelvy, is a medication used for the acute (immediate) treatment of migraine with or without aura (a sensory phenomenon or visual disturbance) in adults. It is not indicated for the preventive treatment of migraine. Ubrogepant is a small-molecule calcitonin gene-related peptide receptor antagonist. It is the first drug in this class approved for the acute treatment of migraine. The most common side effects are nausea, tiredness and dry mouth. Ubrogepant is contraindicated for co-administration with strong CYP3A4 inhibitors. (en)
- Уброгепант — лекарственный препарат для лечения мигрени. Одобрен для применения: США(2019). (ru)
|
| rdfs:label
|
- Ubrogepant (fr)
- Уброгепант (ru)
- Ubrogepant (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
