| dbo:abstract
|
- Sermorelin acetate (INN; brand names Geref, Gerel), also known as GHRH (1-29), is a peptide analogue of growth hormone-releasing hormone (GHRH) which is used as a diagnostic agent to assess growth hormone (GH) secretion for the purpose of diagnosing growth hormone deficiency. It is a 29-amino acid polypeptide representing the 1–29 fragment from endogenous human GHRH, thought to be the shortest fully functional fragment of GHRH. (en)
- La sermorelina è un analogo dell'ormone di rilascio della somatotropina umano (GHRH) di cui rappresenta il frammento 1-29. Viene utilizzata per la diagnosi e per il trattamento delle condizioni patologiche da deficit di ormone della crescita nei bambini in quanto stimola la produzione di tale ormone agonizzando i recettori del GHRH presenti nell'ipofisi. (it)
- Sermorelina (INN: Sermorelin) – polipeptyd zbudowany z pierwszych 29 aminokwasów somatoliberyny, stosowany jest jako czynnik uwalniający somatotropinę w teście oceniającym zdolność komórek przedniego płata przysadki do wytwarzania hormonu wzrostu oraz w leczeniu niedoboru hormon wzrostu u dzieci. (pl)
|
| dbo:alternativeName
| |
| dbo:casNumber
| |
| dbo:chEBI
| |
| dbo:chEMBL
| |
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5695 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chebi
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:drugbank
| |
| dbp:h
| |
| dbp:iupacName
|
- (L)-Tyrosyl-(L)-alanyl-(L)-α-aspartyl-(L)-alanyl-(L)-isoleucyl-(L)-phenylalanyl-(L)-threonyl-(L)-asparaginyl-(L)-seryl-(L)-tyrosyl-(L)-arginyl-(L)-lysyl-(L)-valyl-(L)-leucylglycyl-(L)-glutaminyl-(L)-leucyl-(L)-seryl-(L)-alanyl-(L)-arginyl-(L)-lysyl-(L)-leucyl-(L)-leucyl-(L)-glutaminyl-(L)-α-aspartyl-(L)-isoleucyl-(L)-methionyl-(L)-seryl-(L)-argininamide (en)
|
| dbp:kegg
| |
| dbp:legalUs
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pregnancyUs
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:s
| |
| dbp:smiles
|
- CC[C@H][C@@H]NC[C@H]NC[C@H]NC[C@H]NC[C@H]N (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- WGWPRVFKDLAUQJ-MITYVQBRSA-N (en)
|
| dbp:synonyms
| |
| dbp:tradename
| |
| dbp:unii
| |
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:watchedfields
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Sermorelin acetate (INN; brand names Geref, Gerel), also known as GHRH (1-29), is a peptide analogue of growth hormone-releasing hormone (GHRH) which is used as a diagnostic agent to assess growth hormone (GH) secretion for the purpose of diagnosing growth hormone deficiency. It is a 29-amino acid polypeptide representing the 1–29 fragment from endogenous human GHRH, thought to be the shortest fully functional fragment of GHRH. (en)
- La sermorelina è un analogo dell'ormone di rilascio della somatotropina umano (GHRH) di cui rappresenta il frammento 1-29. Viene utilizzata per la diagnosi e per il trattamento delle condizioni patologiche da deficit di ormone della crescita nei bambini in quanto stimola la produzione di tale ormone agonizzando i recettori del GHRH presenti nell'ipofisi. (it)
- Sermorelina (INN: Sermorelin) – polipeptyd zbudowany z pierwszych 29 aminokwasów somatoliberyny, stosowany jest jako czynnik uwalniający somatotropinę w teście oceniającym zdolność komórek przedniego płata przysadki do wytwarzania hormonu wzrostu oraz w leczeniu niedoboru hormon wzrostu u dzieci. (pl)
|
| rdfs:label
|
- Sermorelina (it)
- Sermorelina (pl)
- Sermorelin (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
