| dbo:abstract
|
- Gantacurium chloride (formerly recognized as GW280430A and as AV430A) is a new experimental neuromuscular blocking drug or skeletal muscle relaxant in the category of non-depolarizing neuromuscular-blocking drugs, used adjunctively in surgical anesthesia to facilitate endotracheal intubation and to provide skeletal muscle relaxation during surgery or mechanical ventilation.Gantacurium is not yet available for widespread clinical use: it is currently undergoing Phase III clinical development. (en)
|
| dbo:bioavailability
| |
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 48412 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:bioavailability
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:cl
| |
| dbp:eliminationHalfLife
| |
| dbp:excretion
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:metabolism
|
- rapid inactivation by endogenous cysteine adduct formation followed by slow ester hydrolysis (en)
|
| dbp:n
| |
| dbp:o
| |
| dbp:proteinBound
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- C[N@+]1CCCOC/C/Cl.[Cl-].[Cl-] (en)
|
| dbp:stdinchi
| |
| dbp:unii
| |
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Gantacurium chloride (formerly recognized as GW280430A and as AV430A) is a new experimental neuromuscular blocking drug or skeletal muscle relaxant in the category of non-depolarizing neuromuscular-blocking drugs, used adjunctively in surgical anesthesia to facilitate endotracheal intubation and to provide skeletal muscle relaxation during surgery or mechanical ventilation.Gantacurium is not yet available for widespread clinical use: it is currently undergoing Phase III clinical development. (en)
|
| rdfs:label
|
- Gantacurium chloride (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
