| dbo:abstract
|
- Oxprenoate potassium (developmental code name RU-28318) is a synthetic steroidal antimineralocorticoid which was never marketed. The affinities of oxprenoate potassium for the steroid hormone receptors have been reported. (en)
|
| dbo:casNumber
| |
| dbo:class
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3059 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:h
| |
| dbp:iupacName
|
- potassium 3-[-17-Hydroxy-10,13-dimethyl-3-oxo-7-propyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate (en)
|
| dbp:k
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CCC[C@@H]1CC2=CCCC[C@@]2C.[K+] (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- HXJITUGMCJCKCE-UYOQDFFISA-M (en)
|
| dbp:synonyms
|
- RU-28318; 17α-Hydroxy-3-oxo-7α-propylpregn-4-ene-21-carboxylic acid monopotassium salt (en)
|
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Oxprenoate potassium (developmental code name RU-28318) is a synthetic steroidal antimineralocorticoid which was never marketed. The affinities of oxprenoate potassium for the steroid hormone receptors have been reported. (en)
|
| rdfs:label
|
- Oxprenoate potassium (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
