| dbo:abstract
|
- Levonorgestrel acetate (LNG-A), or levonorgestrel 17β-acetate, also known as 3-ketonorgestimate, is a progestin which was never marketed. It is a progestogen ester and is the C17β acetate ester and a prodrug of levonorgestrel. Norgestimate is the C3 oxime of LNG-A. The drug is a minor active metabolite of norgestimate, which is a prodrug of norelgestromin and to a lesser extent of levonorgestrel and LNG-A. LNG-A has high affinity for the progesterone receptor, about 135% of that of promegestone (relative to 150% for levonorgestrel). Along with levonorgestrel butanoate, LNG-A was investigated as a hormonal contraceptive by the Population Council. (en)
|
| dbo:casNumber
| |
| dbo:class
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5416 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:casSupplemental
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:h
| |
| dbp:iupacName
|
- [-13-Ethyl-17-ethynyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (en)
|
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CC[C@]12CC[C@H]3[C@H]CCC4=CCCC[C@H]34 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- YDQDJLTYVZAOQX-GOMYTPFNSA-N (en)
|
| dbp:synonyms
|
- LNG-A; LNGA; 3-Ketonorgestimate; Levonorgestrel 17β-acetate; --Norgestrel 17β-acetate; 17α-Ethynyl-18-methylestr-4-en-17β-ol-3-one 17β-acetate; 17β-Acetoxy-13β-ethyl-17α-ethynylgon-4-en-3-one (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Levonorgestrel acetate (LNG-A), or levonorgestrel 17β-acetate, also known as 3-ketonorgestimate, is a progestin which was never marketed. It is a progestogen ester and is the C17β acetate ester and a prodrug of levonorgestrel. Norgestimate is the C3 oxime of LNG-A. The drug is a minor active metabolite of norgestimate, which is a prodrug of norelgestromin and to a lesser extent of levonorgestrel and LNG-A. LNG-A has high affinity for the progesterone receptor, about 135% of that of promegestone (relative to 150% for levonorgestrel). Along with levonorgestrel butanoate, LNG-A was investigated as a hormonal contraceptive by the Population Council. (en)
|
| rdfs:label
|
- Levonorgestrel acetate (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
