| dbo:abstract
|
- Estradiol undecylenate (EUe; developmental code name SH-368) is an estrogen medication and estrogen ester which was never marketed. It is the C17β undecenoate (undecylenate) ester of estradiol. Following an intramuscular injection, EUe has a very prolonged effect, exceeding that of other estradiol esters like estradiol valerate and estradiol enanthate. Due to its very long duration of action, EUe releases only subthreshold amounts of estradiol at conventional doses. However, this may still be useful in menopausal hormone therapy. (en)
|
| dbo:casNumber
| |
| dbo:class
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 5292 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:h
| |
| dbp:iupacName
|
- [-3-Hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] undec-10-enoate (en)
|
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- C[C@]12CC[C@H]3[C@H]CCC4=C3C=CCO (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- VJTIEHBTPQORML-GVGNIZHQSA-N (en)
|
| dbp:synonyms
|
- SH-368; Estradiol undecenoate; Estra-1,3,5-triene-3,17β-diol 17β- (en)
|
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Estradiol undecylenate (EUe; developmental code name SH-368) is an estrogen medication and estrogen ester which was never marketed. It is the C17β undecenoate (undecylenate) ester of estradiol. Following an intramuscular injection, EUe has a very prolonged effect, exceeding that of other estradiol esters like estradiol valerate and estradiol enanthate. Due to its very long duration of action, EUe releases only subthreshold amounts of estradiol at conventional doses. However, this may still be useful in menopausal hormone therapy. (en)
|
| rdfs:label
|
- Estradiol undecylenate (en)
|
| owl:differentFrom
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
