| dbo:abstract
|
- Clocortolone pivalate (brand names Cilder, Cloderm, Purantix), also known as clocortolone trimethylacetate, is a synthetic glucocorticoid corticosteroid and corticosteroid ester which is marketed in the United States and Austria. It is the C21 pivalate (trimethylacetate) ester of clocortolone, and acts as a prodrug of clocortolone in the body. (en)
|
| dbo:alternativeName
|
- Cilder, Cloderm, Purantix (en)
|
| dbo:casNumber
| |
| dbo:chEBI
| |
| dbo:chEMBL
| |
| dbo:class
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4102 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chebi
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:cl
| |
| dbp:class
| |
| dbp:f
| |
| dbp:h
| |
| dbp:iupacName
|
- [2-[-9-Chloro-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2-dimethylpropanoate (en)
|
| dbp:kegg
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- C[C@@H]1C[C@H]2[C@@H]3C[C@@H]F (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- SXYZQZLHAIHKKY-GSTUPEFVSA-N (en)
|
| dbp:synonyms
|
- Clocortolone trimethylacetate; CL-68; SH-863; 9α-Chloro-6α-fluoro-11β,21-dihydroxy-16α-methylpregna-1,4-diene-3,20-dione 21-pivalate (en)
|
| dbp:tradename
|
- Cilder, Cloderm, Purantix (en)
|
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Clocortolone pivalate (brand names Cilder, Cloderm, Purantix), also known as clocortolone trimethylacetate, is a synthetic glucocorticoid corticosteroid and corticosteroid ester which is marketed in the United States and Austria. It is the C21 pivalate (trimethylacetate) ester of clocortolone, and acts as a prodrug of clocortolone in the body. (en)
|
| rdfs:label
|
- Clocortolone pivalate (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
