| dbo:abstract
|
- Umirolimus (INN/USAN, also called Biolimus) is an immunosuppressant, a macrocyclic lactone, a highly lipophilic derivative of sirolimus. This drug is proprietary to Biosensors International, which uses it in its own drug-eluting stents, and licenses it to partners such as Terumo. Umirolimus inhibits T cell and smooth muscle cell proliferation, and was designed for use in drug eluting stents. This analog has a chemical modification at position 40 of the rapamycin ring. It has potent immunosuppressive properties that are similar to those of sirolimus, but the drug is more rapidly absorbed by the vessel wall, readily attaches and enters smooth muscle cell membranes causing cell cycle arrest at G0, and is comparable to sirolimus in terms of potency. (en)
|
| dbo:alternativeName
|
- Biolimus, Biolimus A9, BA9 (en)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4037 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:kegg
| |
| dbp:molecularWeight
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CCOCCO[C@@H]1CC[C@H]C[C@@H][C@@H]2CC[C@@H]C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- YYSFXUWWPNHNAZ-PKJQJFMNSA-N (en)
|
| dbp:tradename
|
- Biolimus, Biolimus A9, BA9 (en)
|
| dbp:unii
| |
| dbp:verifiedrevid
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Umirolimus (INN/USAN, also called Biolimus) is an immunosuppressant, a macrocyclic lactone, a highly lipophilic derivative of sirolimus. This drug is proprietary to Biosensors International, which uses it in its own drug-eluting stents, and licenses it to partners such as Terumo. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
