| dbo:abstract
|
- Testosterone caproate (TCa), also known as testosterone hexanoate, is an androgen and anabolic steroid and a testosterone ester that is no longer marketed. It was formerly available as a component of Omnadren 250, along with testosterone isocaproate, testosterone phenylpropionate, and testosterone propionate, but this formulation has since been discontinued. (en)
|
| dbo:alternativeName
| |
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4005 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:image
|
- Testosterone caproate molecule ball.png (en)
|
| dbp:iupacName
|
- [-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] hexanoate (en)
|
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- CCCCCCO[C@H]1CC[C@@H]2[C@@]1C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- WIGTZVOQGIFMAV-BKWLFHPQSA-N (en)
|
| dbp:synonyms
|
- TCa; Testosterone hexanoate; 17β-Hydroxyandrost-4-en-3-one hexanoate; 3-Oxoandrost-4-en-17β-yl hexanoate (en)
|
| dbp:tradename
| |
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Testosterone caproate (TCa), also known as testosterone hexanoate, is an androgen and anabolic steroid and a testosterone ester that is no longer marketed. It was formerly available as a component of Omnadren 250, along with testosterone isocaproate, testosterone phenylpropionate, and testosterone propionate, but this formulation has since been discontinued. (en)
|
| rdfs:label
|
- Testosterone caproate (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
