| dbo:abstract
|
- Tametraline (CP-24,441) is the parent of a series of chemical compounds investigated at Pfizer that eventually led to the development of sertraline (CP-51,974-1). Sertraline has been called "3,4-dichloro-tametraline". This is correct but it is an oversimplification in the sense that sertraline is the S,S-isomer whereas tametraline is the 1R,4S-stereoisomer. 1R-Methylamino-4S-phenyl-tetralin is a potent inhibitor of norepinephrine uptake in rat brain synaptosomes, reverses reserpine induced hypothermia in mice, and blocks uptake of 3H-Norepinephrine into rat heart. Tametraline is a norepinephrine-dopamine reuptake inhibitor. Indatraline is an indanamine homolog of tetralin-based tametraline, although in the case of indatraline the product is pm-dichlorinated. (en)
- Tametralina (CP-24,441) é um composto químico precursor de uma série de compostos investigados pela Pfizer que, eventualmente, conduziram ao desenvolvimento de sertralina (CP-51,974-1). (pt)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4583 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:c
| |
| dbp:casNumber
|
- 52760 (xsd:integer)
- 52795 (xsd:integer)
|
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:index2Label
| |
| dbp:iupacName
|
- -N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine (en)
|
| dbp:n
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CN[C@H]C=C2[C@H]1C3=CC=CC=C3 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- NVXPZMLRGBVYQV-WMLDXEAASA-N (en)
|
| dbp:unii
|
- 2 (xsd:integer)
- 440 (xsd:integer)
|
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:watchedfields
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Tametralina (CP-24,441) é um composto químico precursor de uma série de compostos investigados pela Pfizer que, eventualmente, conduziram ao desenvolvimento de sertralina (CP-51,974-1). (pt)
- Tametraline (CP-24,441) is the parent of a series of chemical compounds investigated at Pfizer that eventually led to the development of sertraline (CP-51,974-1). Sertraline has been called "3,4-dichloro-tametraline". This is correct but it is an oversimplification in the sense that sertraline is the S,S-isomer whereas tametraline is the 1R,4S-stereoisomer. 1R-Methylamino-4S-phenyl-tetralin is a potent inhibitor of norepinephrine uptake in rat brain synaptosomes, reverses reserpine induced hypothermia in mice, and blocks uptake of 3H-Norepinephrine into rat heart. (en)
|
| rdfs:label
|
- Tametralina (pt)
- Tametraline (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
