| dbo:abstract
|
- Stercuronium iodide (INN, USAN) (developmental code names MYC-1080, MYSC-1080) is an aminosteroid neuromuscular blocking agent which was never marketed. It acts as a competitive antagonist of the nicotinic acetylcholine receptor (nAChR), and is also reported to be an acetylcholinesterase inhibitor. (en)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2884 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:i
| |
| dbp:iupacName
|
- -N-Ethyl-N,N-dimethylcona-4,6-dienin-3-aminium iodide (en)
|
| dbp:n
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CC[N+][C@H]1CC[C@@]2C.[I-] (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- NZMZXOUHSHDAQQ-VIGAWJBNSA-M (en)
|
| dbp:synonyms
| |
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Stercuronium iodide (INN, USAN) (developmental code names MYC-1080, MYSC-1080) is an aminosteroid neuromuscular blocking agent which was never marketed. It acts as a competitive antagonist of the nicotinic acetylcholine receptor (nAChR), and is also reported to be an acetylcholinesterase inhibitor. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
