| dbo:abstract
|
- Sincalide (INN) is a drug administered by injection to aid in diagnosing disorders of the gallbladder and pancreas. It is the 8-amino acid C-terminal fragment of cholecystokinin, and also known as CCK-8. Common adverse effects following administration include abdominal discomfort and nausea. These effects are more pronounced following rapid infusion. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4583 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
|
- α-aspartyl-O-sulfotyrosylmethionylglycyltryptophylmethionyl-α-aspartylphenylalaninamide (en)
|
| dbp:iupharLigand
| |
| dbp:kegg
| |
| dbp:legalUkComment
|
- Available on a named-patient basis (en)
|
| dbp:legalUs
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pregnancyUs
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:s
| |
| dbp:smiles
|
- CSCC[C@@H]NC[C@H]NC[C@H]N (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- IZTQOLKUZKXIRV-YRVFCXMDSA-N (en)
|
| dbp:synonyms
|
- 1 (xsd:integer)
- 5 (xsd:integer)
|
| dbp:unii
| |
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:watchedfields
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Sincalide (INN) is a drug administered by injection to aid in diagnosing disorders of the gallbladder and pancreas. It is the 8-amino acid C-terminal fragment of cholecystokinin, and also known as CCK-8. Common adverse effects following administration include abdominal discomfort and nausea. These effects are more pronounced following rapid infusion. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
