| dbo:abstract
|
- O-4210 is a drug developed by Organix Inc which acts as a selective dopamine reuptake inhibitor, with good selectivity over the serotonin transporter but its activity at the noradrenaline transporter is not known. It is a thiatropane derivative, related in chemical structure to phenyltropane derivatives such as RTI-126 and RTI-171, but with the amine nitrogen replaced by sulfur, demonstrating that this nitrogen only plays a minor contribution to receptor binding, in a similar manner to the related oxatropane tropoxane. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2327 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:f
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:molecularWeight
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:s
| |
| dbp:smiles
|
- CC1=NOC[C@H]2[C@H]C4=CC=CF (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- LXAGRMZFEDEAAM-VVBDHPJYSA-N (en)
|
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- O-4210 is a drug developed by Organix Inc which acts as a selective dopamine reuptake inhibitor, with good selectivity over the serotonin transporter but its activity at the noradrenaline transporter is not known. It is a thiatropane derivative, related in chemical structure to phenyltropane derivatives such as RTI-126 and RTI-171, but with the amine nitrogen replaced by sulfur, demonstrating that this nitrogen only plays a minor contribution to receptor binding, in a similar manner to the related oxatropane tropoxane. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
