| dbo:abstract
|
- Naltriben is a potent and selective antagonist for the delta opioid receptor, which is used in scientific research. It has similar effects to the more widely used δ antagonist naltrindole, but with different binding affinity for the δ1 and δ2 subtypes, which makes it useful for distinguishing the subtype selectivity of drugs acting at the δ receptors. It also acts as a κ-opioid agonist at high doses. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2817 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:alt
|
- Skeletal formula (en)
- Ball-and-stick model of naltriben (en)
|
| dbp:atcPrefix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:image
|
- Naltriben molecule ball.png (en)
|
| dbp:iupharLigand
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- Oc3c2O[C@H]6c1oc8ccccc8c1C[C@@]5[C@H]4NCC7CC7 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- ZHVWWEYETMPAMX-IFKAHUTRSA-N (en)
|
| dbp:unii
| |
| dbp:verifiedrevid
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Naltriben is a potent and selective antagonist for the delta opioid receptor, which is used in scientific research. It has similar effects to the more widely used δ antagonist naltrindole, but with different binding affinity for the δ1 and δ2 subtypes, which makes it useful for distinguishing the subtype selectivity of drugs acting at the δ receptors. It also acts as a κ-opioid agonist at high doses. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
