| dbo:abstract
|
- N-Phenethylnordesomorphine is an opiate analgesic drug derived from desomorphine by replacing the N-methyl group with β-phenethyl. Since desomorphine is already around eight times more potent than morphine, the additional boost in binding affinity produced by using the larger phenethyl group makes N-phenethylnordesomorphine a highly potent analgesic drug, some 85x more potent than morphine, and a similar strength to the closely related morphinan derivative phenomorphan. (en)
|
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2859 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:chemspiderid
| |
| dbp:drugName
|
- N-Phenethylnordesomorphine (en)
|
| dbp:h
| |
| dbp:iupacName
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- [H][C@@]12[C@]3C6=CC=CC=C6C[C@@H]4[C@]3CCC1 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- JZVQXSYNZPVRTQ-FPRSRYDQSA-N (en)
|
| dbp:verifiedrevid
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- N-Phenethylnordesomorphine is an opiate analgesic drug derived from desomorphine by replacing the N-methyl group with β-phenethyl. Since desomorphine is already around eight times more potent than morphine, the additional boost in binding affinity produced by using the larger phenethyl group makes N-phenethylnordesomorphine a highly potent analgesic drug, some 85x more potent than morphine, and a similar strength to the closely related morphinan derivative phenomorphan. (en)
|
| rdfs:label
|
- N-Phenethylnordesomorphine (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- N-Phenethylnordesomorphine (en)
|
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
