| dbo:abstract
|
- Pseudoindoxylmitragynin (PIM) ist ein potentes atypisches Opioid, das schmerzstillend wirkt und ein drastisch günstigeres Nebenwirkungsprofil als herkömmliche Opioide hat. Es entsteht als metabolisches Umlagerungsprodukt aus dem Kratomalkaloid 7-Hydroxymitragynin. (de)
- Mitragynine pseudoindoxyl is a rearrangement product of 7-hydroxymitragynine. It is an analgesic being more potent than morphine. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4571 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:drugName
|
- Mitragynine pseudoindoxyl (en)
|
| dbp:h
| |
| dbp:image
|
- Mitragynine pseudoindoxyl.png (en)
|
| dbp:iupacName
|
- methyl -2-[-6'-ethyl-4-methoxy-3-oxospiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate (en)
|
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CC[C@H][C@]C[C@@][C@]32NC4=CC=CC=C4C3=O (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- BAEJBRCYKACTAA-WGUOAFTMSA-N (en)
|
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Pseudoindoxylmitragynin (PIM) ist ein potentes atypisches Opioid, das schmerzstillend wirkt und ein drastisch günstigeres Nebenwirkungsprofil als herkömmliche Opioide hat. Es entsteht als metabolisches Umlagerungsprodukt aus dem Kratomalkaloid 7-Hydroxymitragynin. (de)
- Mitragynine pseudoindoxyl is a rearrangement product of 7-hydroxymitragynine. It is an analgesic being more potent than morphine. (en)
|
| rdfs:label
|
- Pseudoindoxylmitragynin (de)
- Mitragynine pseudoindoxyl (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
|
- Mitragynine pseudoindoxyl (en)
|
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
