| dbo:abstract
|
- Fluparoxan (developmental code name GR50360A) is a potent α2-adrenergic receptor antagonist (pKB = 7.9) with excellent selectivity for this receptor over the α1-adrenergic receptor (2,630-fold), and is the only well-studied α2-adrenergic receptor antagonist in its structural family which does not antagonize any variant of the imidazoline receptor. It was shown to possess central α2-adrenoceptor antagonist activity after oral doses in man and was patented as an antidepressant by Glaxo in the early 1980s, but its development was discontinued when the compound failed to show a clear clinical advantage over existing therapies. (en)
|
| dbo:bioavailability
| |
| dbo:casNumber
|
- ((+/-)-hydrochloride)
- 101389-86-0
- 139679-54-2
|
| dbo:fdaUniiCode
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 15703 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:bioavailability
| |
| dbp:c
| |
| dbp:casNumber
|
- 101389 (xsd:integer)
- 139679 (xsd:integer)
|
| dbp:cl
| |
| dbp:eliminationHalfLife
| |
| dbp:excretion
| |
| dbp:f
| |
| dbp:h
| |
| dbp:index2Label
|
- -hydrochloride hemihydrate (en)
|
| dbp:indexLabel
| |
| dbp:iupacName
|
- -rel-5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole hydrochloride hydrate (en)
|
| dbp:metabolism
|
- Greater than 90% excreted as (en)
|
| dbp:n
| |
| dbp:o
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- C1[C@H]2[C@H]OC3=CC=CC=C3F (en)
|
| dbp:synonyms
|
- --5-fluoro-2,3,3a,9a-tetrahydro-1H-[1,4]benzodioxino[2,3-c]pyrrole hydrochloride hemihydrate (en)
|
| dbp:unii
|
- 1 (xsd:integer)
- O53Z6W28DK (en)
|
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Fluparoxan (developmental code name GR50360A) is a potent α2-adrenergic receptor antagonist (pKB = 7.9) with excellent selectivity for this receptor over the α1-adrenergic receptor (2,630-fold), and is the only well-studied α2-adrenergic receptor antagonist in its structural family which does not antagonize any variant of the imidazoline receptor. It was shown to possess central α2-adrenoceptor antagonist activity after oral doses in man and was patented as an antidepressant by Glaxo in the early 1980s, but its development was discontinued when the compound failed to show a clear clinical advantage over existing therapies. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
Enantiomer_and_(-)Enantiomer.svg){kind=link}
Enantiomer_and_(-)Enantiomer.svg){kind=link}
