| dbo:abstract
|
- Eucaine (beta-eucaine) is a drug that was previously used as a local anesthetic. It was designed as an analog of cocaine and was one of the first synthetic chemical compounds to find general use as an anesthetic. It is a white, crystalline solid. Prior to World War I, Britain imported eucaine from Germany. During the war, a team including Jocelyn Field Thorpe and Martha Annie Whiteley developed a synthesis in Britain. The brand name Betacaine can sometimes refer to a preparation containing lidocaine, not eucaine. (en)
|
| dbo:alternativeName
| |
| dbo:casNumber
|
- (unspecified isomer)
- 500-34-5
|
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageExternalLink
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4585 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:casSupplemental
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
|
- [-2,2,6-Trimethylpiperidin-4-yl] benzoate (en)
|
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- C[C@H]1C[C@H]OCC2=CC=CC=C2 (en)
|
| dbp:tradename
| |
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Eucaine (beta-eucaine) is a drug that was previously used as a local anesthetic. It was designed as an analog of cocaine and was one of the first synthetic chemical compounds to find general use as an anesthetic. It is a white, crystalline solid. Prior to World War I, Britain imported eucaine from Germany. During the war, a team including Jocelyn Field Thorpe and Martha Annie Whiteley developed a synthesis in Britain. The brand name Betacaine can sometimes refer to a preparation containing lidocaine, not eucaine. (en)
|
| rdfs:label
| |
| owl:differentFrom
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
_synthesis.svg){kind=link}
_synthesis.svg){kind=link}