| dbo:abstract
|
- Estrone cyanate, or estrone 3-O-cyanate, also known as estrocyanate, is an estrogen and an estrogen ester – specifically, the 3-O-cyanate ester of estrone – which was investigated for potential use in birth control pills but was found to be of relatively low potency and ultimately was never marketed. (en)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3179 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:n
| |
| dbp:o
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- C[C@]12CC[C@@H]3c4cccOC#N (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- OIOQBNDENVAFEU-VXNCWWDNSA-N (en)
|
| dbp:synonyms
|
- Estrocyanate; Estrone 3-O-cyanate; Estrone 3-cyanate (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Estrone cyanate, or estrone 3-O-cyanate, also known as estrocyanate, is an estrogen and an estrogen ester – specifically, the 3-O-cyanate ester of estrone – which was investigated for potential use in birth control pills but was found to be of relatively low potency and ultimately was never marketed. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
