| dbo:abstract
|
- Estradiol diacetate (EDA), or estradiol 3,17β-diacetate, is an estrogen and an estrogen ester—specifically, the C3 and C17β diacetate ester of estradiol—which was never marketed. It is related to the estradiol monoesters estradiol acetate (estradiol 3-acetate; Femtrace) and estradiol 17β-acetate. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:class
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3896 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:h
| |
| dbp:iupacName
|
- [-3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (en)
|
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CCO[C@H]1CC[C@@H]2[C@@]1C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- VQHQLBARMFAKSV-AANPDWTMSA-N (en)
|
| dbp:synonyms
|
- EDA; Estradiol 3,17β-diacetate; NSC-106559 (en)
|
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Estradiol diacetate (EDA), or estradiol 3,17β-diacetate, is an estrogen and an estrogen ester—specifically, the C3 and C17β diacetate ester of estradiol—which was never marketed. It is related to the estradiol monoesters estradiol acetate (estradiol 3-acetate; Femtrace) and estradiol 17β-acetate. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
