| dbo:abstract
|
- قام بتطويره عقار ديروكوتيد (المعروف أيضا باسم MBP8298) باحثان بجامعة ألبرتا (University of Alberta) لعلاج التصلب اللويحي (MS). ديروكوتيد هو الببتيد الاصطناعي الذي يتكون من 17 حمضًا من الأحماض الأمينية المتصلة في تسلسل مطابق للتسلسل الخاص بنسبة بروتين المايلين الأساسي الموجود لدى الإنسان. وتسلسل هذه الأحماض الأمينية السبعة عشرة هو
* H2N-Asp-Glu-Asn-Pro-Val-Val-His-Phe-Phe-Lys-Asn-Ile-Val-Thr-Pro-Arg-Thr-OH (ar)
- Dirucotid, auch als MBP8298 bekannt, ist ein experimenteller immunmodulatorischer Arzneistoff, der zur Behandlung schubförmiger und chronischer Verlaufsformen der multiplen Sklerose (MS) erprobt wurde. Bei Dirucotid handelt es sich um ein synthetisches Peptid, das aus den Aminosäuren 82–98 des basischen Myelinproteins („MBP“) besteht. (de)
- Dirucotide (also known as MBP8298) was developed by two research scientists (Dr. Kenneth G. Warren, MD, FRCP(C) & Ingrid Catz, Senior Scientist) at the University of Alberta for the treatment of Multiple Sclerosis (MS). Dirucotide is a synthetic peptide that consists of 17 amino acids linked in a sequence identical to that of a portion of human myelin basic protein (MBP). The sequence of these 17 amino acids is
* H2N-Asp-Glu-Asn-Pro-Val-Val-His-Phe-Phe-Lys-Asn-Ile-Val-Thr-Pro-Arg-Thr-OH (en)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 7734 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
|
- (L)-α-aspartyl-(L)-α-glutamyl-(L)-asparaginyl-(L)-prolyl-(L)-valyl- (L)-valyl-(L)-histidyl-(L)-phenylalanyl-(L)-phenylalanyl-(L)-lysyl- (L)-asparaginyl-(L)-isoleucyl-(L)-valyl-(L)-threonyl-(L)-prolyl- (L)-arginyl-(L)-threonine (en)
|
| dbp:kegg
| |
| dbp:n
| |
| dbp:o
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- CC[C@H][C@@H]NC[C@H]NC[C@H]NC[C@H]NC[C@H]NC[C@H]NC[C@H]NC[C@H]NC[C@@H]5CCCN5C[C@H]NC[C@H]NC[C@H]N (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- RCTCWZRPYFBGLQ-WMCRPSJMSA-N (en)
|
| dbp:unii
| |
| dbp:verifiedrevid
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- قام بتطويره عقار ديروكوتيد (المعروف أيضا باسم MBP8298) باحثان بجامعة ألبرتا (University of Alberta) لعلاج التصلب اللويحي (MS). ديروكوتيد هو الببتيد الاصطناعي الذي يتكون من 17 حمضًا من الأحماض الأمينية المتصلة في تسلسل مطابق للتسلسل الخاص بنسبة بروتين المايلين الأساسي الموجود لدى الإنسان. وتسلسل هذه الأحماض الأمينية السبعة عشرة هو
* H2N-Asp-Glu-Asn-Pro-Val-Val-His-Phe-Phe-Lys-Asn-Ile-Val-Thr-Pro-Arg-Thr-OH (ar)
- Dirucotid, auch als MBP8298 bekannt, ist ein experimenteller immunmodulatorischer Arzneistoff, der zur Behandlung schubförmiger und chronischer Verlaufsformen der multiplen Sklerose (MS) erprobt wurde. Bei Dirucotid handelt es sich um ein synthetisches Peptid, das aus den Aminosäuren 82–98 des basischen Myelinproteins („MBP“) besteht. (de)
- Dirucotide (also known as MBP8298) was developed by two research scientists (Dr. Kenneth G. Warren, MD, FRCP(C) & Ingrid Catz, Senior Scientist) at the University of Alberta for the treatment of Multiple Sclerosis (MS). Dirucotide is a synthetic peptide that consists of 17 amino acids linked in a sequence identical to that of a portion of human myelin basic protein (MBP). The sequence of these 17 amino acids is
* H2N-Asp-Glu-Asn-Pro-Val-Val-His-Phe-Phe-Lys-Asn-Ile-Val-Thr-Pro-Arg-Thr-OH (en)
|
| rdfs:label
|
- ديروكوتيد (ar)
- Dirucotid (de)
- Dirucotide (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
