| dbo:abstract
|
- 3(3,4-dihydroxy-phenyl) propionic acid commonly referred to as dihydrocaffeic acid or DHCA is a phytochemical found in grapes and other plants. DHCA is known to lower IL-6 production through down regulation of DNMT1 expression and inhibition of DNA methylation of the IL-6 gene in mice. DHCA in combination with malvidin-3′-O-glucoside (Mal-gluc), is effective in promoting resilience against stress by modulating brain synaptic plasticity and peripheral inflammation. DHCA/Mal-gluc also significantly lowered depression like phenotypes in mice that had increased peripheral inflammation caused by transplantation of hematopoietic progenitor cells from other more stress-susceptible mice. (en)
- Ácido di-hidrocafeico, também chamado de ácido 3-(3,4-di-hidroxifenil)propiônico ou ácido 3,4-di-hidroxi-benzenepropanoico ou ácido 3-(3,4-di-hidroxi-fenil)-propiônico, abreviado na literatura como DHCA (do inglês dihydrocaffeic acid), é o composto químico orgânico com fórmula C9H10O4, SMILES C1(=C(C=CC(=C1)CCC(=O)O)O)O, massa molecular 182,176 g/mol, classificado com o número CAS 1078-61-1. Possui propriedades antioxidantes. (pt)
|
| dbo:iupacName
|
- 3-(3,4-Dihydroxyphenyl)propanoic acid (en)
|
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2833 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:imagefile
|
- Dihydrocaffeic acid.svg (en)
|
| dbp:pin
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- 3(3,4-dihydroxy-phenyl) propionic acid commonly referred to as dihydrocaffeic acid or DHCA is a phytochemical found in grapes and other plants. DHCA is known to lower IL-6 production through down regulation of DNMT1 expression and inhibition of DNA methylation of the IL-6 gene in mice. DHCA in combination with malvidin-3′-O-glucoside (Mal-gluc), is effective in promoting resilience against stress by modulating brain synaptic plasticity and peripheral inflammation. DHCA/Mal-gluc also significantly lowered depression like phenotypes in mice that had increased peripheral inflammation caused by transplantation of hematopoietic progenitor cells from other more stress-susceptible mice. (en)
- Ácido di-hidrocafeico, também chamado de ácido 3-(3,4-di-hidroxifenil)propiônico ou ácido 3,4-di-hidroxi-benzenepropanoico ou ácido 3-(3,4-di-hidroxi-fenil)-propiônico, abreviado na literatura como DHCA (do inglês dihydrocaffeic acid), é o composto químico orgânico com fórmula C9H10O4, SMILES C1(=C(C=CC(=C1)CCC(=O)O)O)O, massa molecular 182,176 g/mol, classificado com o número CAS 1078-61-1. Possui propriedades antioxidantes. (pt)
|
| rdfs:label
|
- Dihydrocaffeic acid (en)
- Ácido di-hidrocafeico (pt)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
