| dbo:abstract
|
- Clostebol acetate (BAN) (brand names Macrobin, Steranabol, Alfa-Trofodermin, Megagrisevit), also known as 4-chlorotestosterone 17β-acetate (4-CLTA) or as 4-chloroandrost-4-en-17β-ol-3-one 17β-acetate, is a synthetic, injected anabolic-androgenic steroid (AAS) and a derivative of testosterone that is marketed in Germany and Italy. It is an androgen ester – specifically, the C17β acetate ester of clostebol (4-chlorotestosterone) – and acts as a prodrug of clostebol in the body. Clostebol acetate is administered via intramuscular injection. (en)
|
| dbo:alternativeName
|
- Macrobin, Steranabol, Alfa-Trofodermin, Megagrisevit (en)
|
| dbo:casNumber
| |
| dbo:chEBI
| |
| dbo:chEMBL
| |
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4259 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chebi
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:cl
| |
| dbp:drugbank
| |
| dbp:h
| |
| dbp:image
|
- Clostebol acetate molecule ball.png (en)
|
| dbp:iupacName
|
- [-4-Chloro-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (en)
|
| dbp:kegg
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- CCO[C@H]1CC[C@@H]2[C@@]1C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- XYGMEFJSKQEBTO-KUJXMBTLSA-N (en)
|
| dbp:synonyms
| |
| dbp:tradename
|
- Macrobin, Steranabol, Alfa-Trofodermin, Megagrisevit (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Clostebol acetate (BAN) (brand names Macrobin, Steranabol, Alfa-Trofodermin, Megagrisevit), also known as 4-chlorotestosterone 17β-acetate (4-CLTA) or as 4-chloroandrost-4-en-17β-ol-3-one 17β-acetate, is a synthetic, injected anabolic-androgenic steroid (AAS) and a derivative of testosterone that is marketed in Germany and Italy. It is an androgen ester – specifically, the C17β acetate ester of clostebol (4-chlorotestosterone) – and acts as a prodrug of clostebol in the body. Clostebol acetate is administered via intramuscular injection. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
