| dbo:abstract
|
- Casopitant (INN), former tentative trade names Rezonic (U.S.) and Zunrisa (Europe), is an NK1 receptor antagonist which was undergoing research for the treatment of chemotherapy-induced nausea and vomiting. It was under development by GlaxoSmithKline. In July 2008, the company filed a marketing authorisation application with the European Medicines Agency. The application was withdrawn and development was discontinued in September 2009 because GlaxoSmithKline decided that further safety assessment was necessary. However, a 2022 review listed casopitant as under development as a potential novel antidepressant for the treatment of major depressive disorder, with a phase 2 clinical trial having been completed. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:fdaUniiCode
| |
| dbo:kegg
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4689 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:atcPrefix
| |
| dbp:atcSuffix
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:f
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:kegg
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CC1=C[C@@H]2C[C@H]N4CCNCC (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- XGGTZCKQRWXCHW-JRLVAEJTSA-N (en)
|
| dbp:synonyms
|
- GW679769; GW-679769; -4--N-{-1-[3,5-bisphenyl]ethyl}-2--N-methylpiperidine-1-carboxamide (en)
|
| dbp:unii
| |
| dbp:verifiedrevid
| |
| dbp:watchedfields
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- Casopitant (INN), former tentative trade names Rezonic (U.S.) and Zunrisa (Europe), is an NK1 receptor antagonist which was undergoing research for the treatment of chemotherapy-induced nausea and vomiting. It was under development by GlaxoSmithKline. In July 2008, the company filed a marketing authorisation application with the European Medicines Agency. The application was withdrawn and development was discontinued in September 2009 because GlaxoSmithKline decided that further safety assessment was necessary. However, a 2022 review listed casopitant as under development as a potential novel antidepressant for the treatment of major depressive disorder, with a phase 2 clinical trial having been completed. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
