| dbo:abstract
|
- Bolandiol dipropionate (USAN) (brand names Anabiol, Storinal; former developmental code name SC-7525), or bolandiol propionate (JAN), also known as norpropandrolate or 19-nor-4-androstenediol dipropionate, as well as estr-4-ene-3β,17β-diol 3,17-dipropionate, is a synthetic anabolic-androgenic steroid (AAS) and derivative of 19-nortestosterone (nandrolone). It is an androgen ester – specifically, the 3,17-dipropionate ester of bolandiol (19-nor-4-androstenediol). (en)
|
| dbo:alternativeName
| |
| dbo:casNumber
| |
| dbo:chEBI
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3195 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chebi
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
|
- [-13-Methyl-17-propanoyloxy-1,2,3,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] propanoate (en)
|
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CCCO[C@H]1CC[C@@H]2[C@H]3CC[C@]4C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- JFAXVZXNIGIDDA-KDWXAGHCSA-N (en)
|
| dbp:synonyms
| |
| dbp:tradename
| |
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Bolandiol dipropionate (USAN) (brand names Anabiol, Storinal; former developmental code name SC-7525), or bolandiol propionate (JAN), also known as norpropandrolate or 19-nor-4-androstenediol dipropionate, as well as estr-4-ene-3β,17β-diol 3,17-dipropionate, is a synthetic anabolic-androgenic steroid (AAS) and derivative of 19-nortestosterone (nandrolone). It is an androgen ester – specifically, the 3,17-dipropionate ester of bolandiol (19-nor-4-androstenediol). (en)
|
| rdfs:label
|
- Bolandiol dipropionate (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
