| dbo:abstract
|
- Acyline (developmental code name MER-104) is a gonadotropin-releasing hormone analogue (GnRH analogue) and gonadotropin-releasing hormone antagonist (GnRH antagonist) which was never marketed. It has been shown to suppress gonadotropin and testosterone levels in men. Acyline is a peptide and under normal circumstances is not orally active. For this reason, it has instead been administered by subcutaneous injection. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:class
| |
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4947 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:cl
| |
| dbp:class
| |
| dbp:drugbank
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- C[C@H]NC[C@@H]1CCCN1C[C@H]NC[C@H]NC[C@@H]NC[C@H]NC[C@H]NC[C@@H]NC[C@@H]NC[C@@H]NCC (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- ZWNUQDJANZGVFO-YHSALVGYSA-N (en)
|
| dbp:synonyms
| |
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Acyline (developmental code name MER-104) is a gonadotropin-releasing hormone analogue (GnRH analogue) and gonadotropin-releasing hormone antagonist (GnRH antagonist) which was never marketed. It has been shown to suppress gonadotropin and testosterone levels in men. Acyline is a peptide and under normal circumstances is not orally active. For this reason, it has instead been administered by subcutaneous injection. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
