| dbo:abstract
|
- 1P-LSD or 1-propionyl-lysergic acid diethylamide is a psychedelic drug of the lysergamide class that is a derivative and functional analogue of LSD and a homologue of ALD-52. It has been sold online as a designer drug since 2015. It modifies the LSD molecule by adding a propionyl group to the nitrogen molecule of LSD's indole. (en)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 11726 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
|
- -N,N-Diethyl-7-methyl-4-propanoyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (en)
|
| dbp:legalDe
| |
| dbp:legalStatus
|
- Illegal in Czech Republic, Denmark, Estonia, France, Japan, Latvia, Lithuania, Norway, Romania, Singapore, Sweden, Switzerland (en)
|
| dbp:legalUk
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CCNC[C@H]1CN[C@@H]2Cc3cnc4ccccc34 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- JSMQOVGXBIDBIE-OXQOHEQNSA-N (en)
|
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- 1P-LSD or 1-propionyl-lysergic acid diethylamide is a psychedelic drug of the lysergamide class that is a derivative and functional analogue of LSD and a homologue of ALD-52. It has been sold online as a designer drug since 2015. It modifies the LSD molecule by adding a propionyl group to the nitrogen molecule of LSD's indole. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
