| dbo:abstract
|
- 16α-Iodo-E2, or 16α-iodoestradiol, is a synthetic, steroidal, potent estrogen with slight preference for the ERα over the ERβ that is used in scientific research. The KD of 16α-iodo-E2 for the ERα is 0.6 nM and for the ERβ is 0.24 nM, a 4-fold difference in affinity, whereas estradiol is considered to have similar affinity for the two receptor subtypes. Unlike the case of the much weaker estriol (16α-hydroxyestradiol), 16α-iodo-E2 is considered to be equipotent with estradiol in terms of estrogenic activity. Radiolabeled [16α-125I]iodo-E2 has been employed in imaging to study the estrogen receptor. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3948 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:i
| |
| dbp:iupacName
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- C[C@]12CC[C@H]3[C@H]CCC4=C3C=CCO (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- SSYGGPAGDDGXAF-ZXXIGWHRSA-N (en)
|
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:comment
|
- 16α-Iodo-E2, or 16α-iodoestradiol, is a synthetic, steroidal, potent estrogen with slight preference for the ERα over the ERβ that is used in scientific research. The KD of 16α-iodo-E2 for the ERα is 0.6 nM and for the ERβ is 0.24 nM, a 4-fold difference in affinity, whereas estradiol is considered to have similar affinity for the two receptor subtypes. Unlike the case of the much weaker estriol (16α-hydroxyestradiol), 16α-iodo-E2 is considered to be equipotent with estradiol in terms of estrogenic activity. Radiolabeled [16α-125I]iodo-E2 has been employed in imaging to study the estrogen receptor. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
