| dbo:abstract
|
- Methyltestosterone 3-hexyl ether (brand names Androgénol, Enoltestovis, Enoltestovister), or 17α-methyltestosterone 3-hexyl enol ether, also known as 17α-methylandrost-3,5-dien-17β-ol-3-one 3-hexyl ether, is a synthetic anabolic-androgenic steroid and an androgen ether – specifically, the 3-hexyl ether of methyltestosterone. (en)
|
| dbo:alternativeName
|
- Androgénol, Enoltestovis, Enoltestovister (en)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2848 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CCCCCCOC1=CC2=CC[C@@H]3[C@@H]CC[C@]4C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- QPBGOXFXPXMJBT-UXUCURBISA-N (en)
|
| dbp:synonyms
| |
| dbp:tradename
|
- Androgénol, Enoltestovis, Enoltestovister (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Methyltestosterone 3-hexyl ether (brand names Androgénol, Enoltestovis, Enoltestovister), or 17α-methyltestosterone 3-hexyl enol ether, also known as 17α-methylandrost-3,5-dien-17β-ol-3-one 3-hexyl ether, is a synthetic anabolic-androgenic steroid and an androgen ether – specifically, the 3-hexyl ether of methyltestosterone. (en)
|
| rdfs:label
|
- Methyltestosterone 3-hexyl ether (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
