| dbo:casNumber
| |
| dbo:description
|
- chemical compound (en)
- chemische Verbindung (de)
- chemische verbinding (nl)
- compositum chemicum (la)
- composé chimique (fr)
- compuestu químicu (ast)
- хімічна сполука (uk)
- քիմիական միացություն (hy)
- химическое соединение (ru)
|
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
|
- [-3--13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-cyclopentylpropanoate (en)
|
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- C[C@]12CC[C@H]3[C@H]CCC5=C3C=CCOCCCC6CCCC6 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- PVDLDDBZCWVZBX-FTWOUWFXSA-N (en)
|
| dbp:synonyms
|
- EDC; Estradiol 3,17β-dicypionate; Estradiol dicipionate; Estradiol dicyclopentylpropionate; Estradiol dicyclopentanepropionate; Estra-1,3,5-triene-3,17β-diol 3,17β-di (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dct:subject
| |
| rdf:type
| |
| rdfs:label
|
- Estradiol dicypionate (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |