Si 363 is a bifunctional organosilane chemical used in the reinforcement of rubber articles, especially tires. SI363 is the trade name of a silane bonding agent in the trialkoxymercaptoalkyl-silane class and of formula SH(CH2)H3Si(OCHH2CHH3)(O(CHH2CHH2O)H5(CHH2)H12CHH3)H2. When applied to tires, Si 363 reduces rolling resistance, thus leading to increased fuel economy. Both and sulfur entities are present within its molecular structure.
Attributes | Values |
---|---|
rdf:type | |
rdfs:label |
|
rdfs:comment |
|
dcterms:subject | |
Wikipage page ID |
|
Wikipage revision ID |
|
Link from a Wikipage to another Wikipage | |
sameAs | |
dbp:wikiPageUsesTemplate | |
has abstract |
|
gold:hypernym | |
prov:wasDerivedFrom | |
page length (characters) of wiki page |
|
foaf:isPrimaryTopicOf | |
is foaf:primaryTopic of |