| dbo:abstract
|
- 11β-Methyl-19-nortestosterone (11β-MNT) is a synthetic and orally active anabolic–androgenic steroid (AAS) and a derivative of nandrolone (19-nortestosterone) which was developed by the Contraceptive Development Branch (CDB) of the National Institute of Child Health and Human Development (NICHD) and has not been marketed at this time. The C17β dodecylcarbonate ester of 11β-MNT, 11β-methyl-19-nortestosterone 17β-dodecylcarbonate (11β-MNTDC) (CDB-4754), is a prodrug of 11β-MNT. Along with the closely related AAS dimethandrolone (7α,11β-dimethyl-19-nortestosterone; CDB-1321) and its ester prodrug dimethandrolone undecanoate (CDB-4521), 11β-MNT and 11β-MNTDC are under investigation as potential male contraceptives and to treat male hypogonadism. (en)
|
| dbo:casNumber
|
- 18046-77-0
- 904901-01-5 (dodecylcarbonate)
|
| dbo:class
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 8073 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:casSupplemental
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:smiles
|
- C[C@H]1C[C@]2[C@@H]CC[C@H]2[C@@H]3CCC4=CCCC[C@@H]4[C@@H]13 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- QCNNHARIRLYUAB-CTPXPINYSA-N (en)
|
| dbp:synonyms
| |
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- 11β-Methyl-19-nortestosterone (11β-MNT) is a synthetic and orally active anabolic–androgenic steroid (AAS) and a derivative of nandrolone (19-nortestosterone) which was developed by the Contraceptive Development Branch (CDB) of the National Institute of Child Health and Human Development (NICHD) and has not been marketed at this time. (en)
|
| rdfs:label
|
- 11β-Methyl-19-nortestosterone (en)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
