| dbo:abstract
|
- WAY-163,909 is a drug which acts as a potent and reasonably selective agonist for the serotonin 5-HT2C receptor. It has antipsychotic-like effects in animal models, and has been used to study the role of the 5-HT2C receptor subtype in the action of addictive drugs such as nicotine and methamphetamine. (en)
|
| dbo:casNumber
| |
| dbo:chEMBL
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 4892 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:n
| |
| dbp:pubchem
| |
| dbp:smiles
|
- C1C[C@H]2[C@@H]N3CCNCC4=C3C2=CC=C4 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- XOSKJKGKWRIMGV-DGCLKSJQSA-N (en)
|
| dbp:unii
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- WAY-163,909 is a drug which acts as a potent and reasonably selective agonist for the serotonin 5-HT2C receptor. It has antipsychotic-like effects in animal models, and has been used to study the role of the 5-HT2C receptor subtype in the action of addictive drugs such as nicotine and methamphetamine. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
