| dbo:abstract
|
- Pentarane A, also known as D'6-pentarane or pregna-D'6-pentarane, as well as 16α,17α-cyclohexanoprogesterone, 16α,17α-tetramethylenepregn-4-ene-3,20-dione, or 17α-acetyl-16β,24-cyclo-21-norchol-4-en-3-one, is a steroidal progestin that was developed by the Zelinskii Institute of Organic Chemistry of the Russian Academy of Sciences and was never marketed. The 6α-methylated analogue of pentarane A is known as mecigestone or as pentarane B. (en)
|
| dbo:casNumber
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3271 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CC[C@@]12CCCC[C@@H]1C[C@@H]3[C@@]2C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- QRVBGQLTPQQFJY-IEHCJHDVSA-N (en)
|
| dbp:synonyms
|
- D'6-Pentarane; Pregna-D'6-pentarane; 16α,17α-Cyclohexanoprogesterone; 16α,17α-Tetramethylenepregn-4-ene-3,20-dione; 17α-Acetyl-16β,24-cyclo-21-norchol-4-en-3-one (en)
|
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Pentarane A, also known as D'6-pentarane or pregna-D'6-pentarane, as well as 16α,17α-cyclohexanoprogesterone, 16α,17α-tetramethylenepregn-4-ene-3,20-dione, or 17α-acetyl-16β,24-cyclo-21-norchol-4-en-3-one, is a steroidal progestin that was developed by the Zelinskii Institute of Organic Chemistry of the Russian Academy of Sciences and was never marketed. The 6α-methylated analogue of pentarane A is known as mecigestone or as pentarane B. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
