| dbo:abstract
|
- OX1001 (saquinavir-NO) is an experimental drug being developed by currently undergoing clinical studies and investigations for the treatment of cancer. OX1001 is a nitrate ester analog of the approved HIV protease inhibitor, saquinavir. This modification increases the anti-cancer property while decreasing toxicity of the drug. OX1001 shows broad activity against cancer cells but is particularly effective against hematological, prostate, and melanoma cancers as seen in in vitro and in vivo studies. (en)
|
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 6084 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:legalStatus
| |
| dbp:n
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CCNC[C@@H]1C[C@@H]2CCCC[C@@H]2CN1C[C@H]O[N+][O-] (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- SPHXNRBWPVEVAS-UGJKXSETSA-N (en)
|
| dbp:verifiedfields
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| gold:hypernym
| |
| rdf:type
| |
| rdfs:comment
|
- OX1001 (saquinavir-NO) is an experimental drug being developed by currently undergoing clinical studies and investigations for the treatment of cancer. OX1001 is a nitrate ester analog of the approved HIV protease inhibitor, saquinavir. This modification increases the anti-cancer property while decreasing toxicity of the drug. OX1001 shows broad activity against cancer cells but is particularly effective against hematological, prostate, and melanoma cancers as seen in in vitro and in vivo studies. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
