| dbo:abstract
|
- Estrone sulfate (E1S) is an estrogen medication and naturally occurring steroid hormone. It is used in menopausal hormone therapy among other indications. As the sodium salt (sodium estrone sulfate), it is the major estrogen component of conjugated estrogens (Premarin) and esterified estrogens (Estratab, Menest). In addition, E1S is used on its own as the piperazine salt estropipate (piperazine estrone sulfate; Ogen). The compound also occurs as a major and important metabolite of estradiol and estrone. E1S is most commonly taken by mouth, but in the form of Premarin can also be taken by parenteral routes such as transdermal, vaginal, and injection. (en)
|
| dbo:casNumber
|
- 438-67-5 (sodium)
- 481-97-0
- 7280-37-7 (piperazine)
|
| dbo:chEBI
| |
| dbo:chEMBL
| |
| dbo:class
| |
| dbo:drugbank
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 13493 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:casSupplemental
|
- 438 (xsd:integer)
- 7280 (xsd:integer)
|
| dbp:chebi
| |
| dbp:chembl
| |
| dbp:chemspiderid
| |
| dbp:class
| |
| dbp:drugbank
| |
| dbp:eliminationHalfLife
| |
| dbp:h
| |
| dbp:image
|
- Estrone sulfate 3D ball.png (en)
|
| dbp:iupacName
|
- [-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (en)
|
| dbp:iupharLigand
| |
| dbp:metabolism
| |
| dbp:metabolites
|
- • Estradiol (en)
- • Estrone (en)
|
| dbp:o
| |
| dbp:proteinBound
| |
| dbp:pubchem
| |
| dbp:routesOfAdministration
| |
| dbp:s
| |
| dbp:smiles
|
- O=SOc1cc4c[C@H]3CC[C@@]2C (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- JKKFKPJIXZFSSB-CBZIJGRNSA-N (en)
|
| dbp:synonyms
|
- E1S; Oestrone sulfate; Estrone 3-sulfate; Estra-1,3,5-trien-17-one 3-sulfate (en)
|
| dbp:unii
| |
| dbp:verifiedfields
| |
| dbp:verifiedrevid
| |
| dbp:watchedfields
| |
| dbp:width
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- Estrone sulfate (E1S) is an estrogen medication and naturally occurring steroid hormone. It is used in menopausal hormone therapy among other indications. As the sodium salt (sodium estrone sulfate), it is the major estrogen component of conjugated estrogens (Premarin) and esterified estrogens (Estratab, Menest). In addition, E1S is used on its own as the piperazine salt estropipate (piperazine estrone sulfate; Ogen). The compound also occurs as a major and important metabolite of estradiol and estrone. E1S is most commonly taken by mouth, but in the form of Premarin can also be taken by parenteral routes such as transdermal, vaginal, and injection. (en)
|
| rdfs:label
|
- Estrone sulfate (medication) (en)
|
| rdfs:seeAlso
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
