| dbo:abstract
|
- 19-Noretiocholanolone, also known as 5β-estran-3α-ol-17-one, is a metabolite of nandrolone (19-nortestosterone) and bolandione (19-norandrostenedione) that is formed by 5α-reductase. It is on the list of substances prohibited by the World Anti-Doping Agency since it is a detectable metabolite of nandrolone, an anabolic-androgenic steroid (AAS). Traces of 19-noretiocholanolone may be naturally present in human urine. Consumption of boar meat, liver, kidneys and heart have been found to increase urinary 19-noretiocholanolone output. (en)
|
| dbo:casNumber
| |
| dbo:fdaUniiCode
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 3452 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:chemspiderid
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:o
| |
| dbp:pubchem
| |
| dbp:smiles
|
- C[C@]12CC[C@@H]3[C@H]4CC[C@H]O (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- UOUIARGWRPHDBX-DHMVHTBWSA-N (en)
|
| dbp:synonyms
|
- Noretiocholanolone; 5β-Estran-3α-ol-17-one; 3α-Hydroxy-5β-estran-17-one (en)
|
| dbp:unii
| |
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- 19-Noretiocholanolone, also known as 5β-estran-3α-ol-17-one, is a metabolite of nandrolone (19-nortestosterone) and bolandione (19-norandrostenedione) that is formed by 5α-reductase. It is on the list of substances prohibited by the World Anti-Doping Agency since it is a detectable metabolite of nandrolone, an anabolic-androgenic steroid (AAS). Traces of 19-noretiocholanolone may be naturally present in human urine. Consumption of boar meat, liver, kidneys and heart have been found to increase urinary 19-noretiocholanolone output. (en)
|
| rdfs:label
|
- 19-Noretiocholanolone (en)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
