Clobenzorex (also known under the brand names Asenlix, Dinintel, Finedal, or Rexigen; or the US slang "greenies") is a stimulant drug used as an anorectic (that is, a medication that suppresses appetite). The drug is legally distributed in Mexico under the trade name Asenlix by the Aventis pharmaceutical corporation. Chemically, clobenzorex is an N-substituted amphetamine analog that is converted to (d) amphetamine soon after ingestion.
| Property | Value |
| dbpedia-owl:Drug/atcPrefix
| |
| dbpedia-owl:Drug/atcSuffix
| |
| dbpedia-owl:Drug/casNumber
| |
| dbpedia-owl:Drug/iupacName
|
- (+)-N-[(2-Chlorophenyl)methyl]-α-methylphenethylamine
|
| dbpedia-owl:atcPrefix
| |
| dbpedia-owl:atcSuffix
| |
| dbpedia-owl:casNumber
| |
| dbpedia-owl:iupacName
|
- (+)-N-[(2-Chlorophenyl)methyl]-α-methylphenethylamine
|
| dbpedia-owl:thumbnail
| |
| dbpprop:abstract
|
- Clobenzorex (also known under the brand names Asenlix, Dinintel, Finedal, or Rexigen; or the US slang "greenies") is a stimulant drug used as an anorectic (that is, a medication that suppresses appetite). The drug is legally distributed in Mexico under the trade name Asenlix by the Aventis pharmaceutical corporation. Chemically, clobenzorex is an N-substituted amphetamine analog that is converted to (d) amphetamine soon after ingestion. In commercial production, clobenzorex is supplied in 30mg doses as the hydrochloride salt in green-tinted capsules. The drug gained use as a prescription anorectic in the 1970s; however, adverse reactions were eventually observed, which led to the prohibition of clobenzorex in the US and certain other countries. In the United States of America, clobenzorex tablets (among other varieties of stimulants, such as amphetamine) have been used by athletes who ingest the drug to reduce fatigue, increase attention, and improve reaction times during athletic activities. The green-tinted Asenlix capsules (generic forms can be seen as half light green, half dark green capsules marked "IFA") are known as "greenies" among US baseball players, a slang term that in current use has expanded to generically refer to any amphetamine-class stimulant.
|
| dbpprop:atcPrefix
| |
| dbpprop:atcSuffix
| |
| dbpprop:c
| |
| dbpprop:casNumber
| |
| dbpprop:cl
| |
| dbpprop:h
| |
| dbpprop:hasPhotoCollection
| |
| dbpprop:iupacName
|
- +)-N-[(2-Chlorophenyl)methyl]-α-methylphenethylamine
|
| dbpprop:molecularWeight
| |
| dbpprop:n
| |
| dbpprop:reference
| |
| dbpprop:smiles
|
- C1=CC=CC=C1CC(C)N([H])CC2=CC=CC=C2Cl
|
| dbpprop:width
| |
| dbpprop:wikiPageUsesTemplate
| |
| rdf:type
| |
| rdfs:comment
|
- Clobenzorex (also known under the brand names Asenlix, Dinintel, Finedal, or Rexigen; or the US slang "greenies") is a stimulant drug used as an anorectic (that is, a medication that suppresses appetite). The drug is legally distributed in Mexico under the trade name Asenlix by the Aventis pharmaceutical corporation. Chemically, clobenzorex is an N-substituted amphetamine analog that is converted to (d) amphetamine soon after ingestion.
|
| rdfs:label
| |
| owl:sameAs
| |
| skos:subject
| |
| foaf:depiction
| |
| foaf:page
| |
| is dbpprop:redirect
of | |
| is owl:sameAs
of | |